27761-26-8 Fast Red B salt
Nome do produto |
Fast Red B salt |
Nome em inglês |
Fast Red B salt;2-methoxy-4-nitrobenzenediazonium |
Fórmula molecular |
C7H6N3O3 |
Peso Molecular |
180.1403 |
InChI |
InChI=1/C7H6N3O3/c1-13-7-4-5(10(11)12)2-3-6(7)9-8/h2-4H,1H3/q+1 |
CAS Registry Number |
27761-26-8 |
EINECS |
248-642-2 |
Estrutura Molecular |
|
Símbolos de perigo |
Xn:Harmful;
|
Códigos de risco |
R20/21:Harmful by inhalation and in contact with skin.;
R33:Danger of cummulative effects.;
|
Descrição da Segurança |
|
|