ChemNet > CAS > 3141-25-1 2,3,4-Tribromothiophene
3141-25-1 2,3,4-Tribromothiophene
| Nome do produto |
2,3,4-Tribromothiophene |
| Nome em inglês |
2,3,4-Tribromothiophene; |
| Fórmula molecular |
C4HBr3S |
| Peso Molecular |
320.8277 |
| InChI |
InChI=1/C4HBr3S/c5-2-1-8-4(7)3(2)6/h1H |
| CAS Registry Number |
3141-25-1 |
| EINECS |
221-545-2 |
| Estrutura Molecular |
|
| Densidade |
2.516g/cm3 |
| Ponto de ebulição |
277.5°C at 760 mmHg |
| índice de refração |
1.671 |
| O ponto de inflamação |
121.6°C |
| Pressão de vapor |
0.00762mmHg at 25°C |
| Símbolos de perigo |
|
| Códigos de risco |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Descrição da Segurança |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
