ChemNet > CAS > 33733-73-2 3-Bromothioanisole
33733-73-2 3-Bromothioanisole
| Nome do produto |
3-Bromothioanisole |
| Nome em inglês |
3-Bromothioanisole; 3-Bromophenyl methyl sulphide; 3-Bromothioanisol/3-Bromophenyl methyl sulphide; 1-Bromo-3-(methylthio)benzene; m-Bromothioanisole; 1-bromo-3-(methylsulfanyl)benzene; 1-(bromosulfanyl)-3-methoxybenzene |
| Fórmula molecular |
C7H7BrOS |
| Peso Molecular |
219.0989 |
| InChI |
InChI=1/C7H7BrOS/c1-9-6-3-2-4-7(5-6)10-8/h2-5H,1H3 |
| CAS Registry Number |
33733-73-2 |
| Estrutura Molecular |
|
| Densidade |
1.567g/cm3 |
| Ponto de ebulição |
278.106°C at 760 mmHg |
| índice de refração |
1.616 |
| O ponto de inflamação |
121.995°C |
| Pressão de vapor |
0.007mmHg at 25°C |
| Símbolos de perigo |
|
| Códigos de risco |
R36/38:Irritating to eyes and skin.;
|
| Descrição da Segurança |
S23:;
S24/25:;
|
|
