ChemNet > CAS > 370-81-0 Oxalic acid bis(cyclohexylidenehydrazide)
370-81-0 Oxalic acid bis(cyclohexylidenehydrazide)
| Nome do produto |
Oxalic acid bis(cyclohexylidenehydrazide) |
| Nome em inglês |
Oxalic acid bis(cyclohexylidenehydrazide); Cuprizon 1; Bis(cyclohexanone)oxaldihydrazone; oxalic bis(cyclohexylidenehydrazide); N,N-oxalylbis(cyclohexanone hydrazone); Cuprizon l; cuprizon; Oxalic acid bis (cyclohexylidenehydrazide); N'~1~,N'~2~-dicyclohexylideneethanedihydrazide |
| Fórmula molecular |
C14H22N4O2 |
| Peso Molecular |
278.3501 |
| InChI |
InChI=1/C14H22N4O2/c19-13(17-15-11-7-3-1-4-8-11)14(20)18-16-12-9-5-2-6-10-12/h1-10H2,(H,17,19)(H,18,20) |
| CAS Registry Number |
370-81-0 |
| EINECS |
206-729-2 |
| Estrutura Molecular |
|
| Densidade |
1.29g/cm3 |
| Ponto de fusão |
208-214℃ |
| índice de refração |
1.625 |
| Símbolos de perigo |
 Xn:Harmful;
|
| Códigos de risco |
R21/22:Harmful in contact with skin and if swallowed.;
|
| Descrição da Segurança |
S2:Keep out of reach of children;
S24/25:Avoid contact with skin and eyes.;
|
|
