ChemNet > CAS > 39499-34-8 5-Methylisoxazole-3-carbonyl chloride
39499-34-8 5-Methylisoxazole-3-carbonyl chloride
| Nome do produto |
5-Methylisoxazole-3-carbonyl chloride |
| Nome em inglês |
5-Methylisoxazole-3-carbonyl chloride; |
| Fórmula molecular |
C5H4ClNO2 |
| Peso Molecular |
145.5438 |
| InChI |
InChI=1/C5H4ClNO2/c1-3-2-4(5(6)8)7-9-3/h2H,1H3 |
| CAS Registry Number |
39499-34-8 |
| EINECS |
254-475-6 |
| Estrutura Molecular |
|
| Densidade |
1.345g/cm3 |
| Ponto de ebulição |
243.7°C at 760 mmHg |
| índice de refração |
1.498 |
| O ponto de inflamação |
101.2°C |
| Pressão de vapor |
0.0317mmHg at 25°C |
| Símbolos de perigo |
 C:Corrosive;
|
| Códigos de risco |
R34:Causes burns.;
|
| Descrição da Segurança |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
