ChemNet > CAS > 42048-11-3 2-Chloro-6-iodotoluene
42048-11-3 2-Chloro-6-iodotoluene
| Nome do produto |
2-Chloro-6-iodotoluene |
| Nome em inglês |
2-Chloro-6-iodotoluene; 1-Chloro-3-iodo-2-methylbenzene; 2-Iodo-6-chlorotoluene |
| Fórmula molecular |
C7H6ClI |
| Peso Molecular |
252.48 |
| InChI |
InChI=1/C7H6ClI/c1-5-6(8)3-2-4-7(5)9/h2-4H,1H3 |
| CAS Registry Number |
42048-11-3 |
| Estrutura Molecular |
|
| Densidade |
1.806g/cm3 |
| Ponto de ebulição |
243°C at 760 mmHg |
| índice de refração |
1.616 |
| O ponto de inflamação |
100.8°C |
| Pressão de vapor |
0.0513mmHg at 25°C |
| Símbolos de perigo |
|
| Códigos de risco |
R36/38:Irritating to eyes and skin.;
|
| Descrição da Segurança |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
