ChemNet > CAS > 4653-11-6 4-(2-Thienyl)butyric acid
4653-11-6 4-(2-Thienyl)butyric acid
| Nome do produto |
4-(2-Thienyl)butyric acid |
| Nome em inglês |
4-(2-Thienyl)butyric acid; 2-Thiophenebutyric acid; 4-(thiophen-2-yl)butanoic acid; 4-thiophen-2-ylbutanoate |
| Fórmula molecular |
C8H9O2S |
| Peso Molecular |
169.2214 |
| InChI |
InChI=1/C8H10O2S/c9-8(10)5-1-3-7-4-2-6-11-7/h2,4,6H,1,3,5H2,(H,9,10)/p-1 |
| CAS Registry Number |
4653-11-6 |
| EINECS |
225-090-0 |
| Estrutura Molecular |
|
| Ponto de ebulição |
296.9°C at 760 mmHg |
| O ponto de inflamação |
133.4°C |
| Pressão de vapor |
0.000628mmHg at 25°C |
| Símbolos de perigo |
|
| Códigos de risco |
|
| Descrição da Segurança |
S24/25:Avoid contact with skin and eyes.;
|
|
