488-87-9 2,5-Dimetilresorcinol
| Nome do produto |
2,5-Dimetilresorcinol |
| Sinônimos |
2,5-dimetilbenzeno-1,3-diol |
| Nome em inglês |
2,5-Dimethylresorcinol;2,5-dimethylbenzene-1,3-diol |
| Fórmula molecular |
C8H10O2 |
| Peso Molecular |
138.1638 |
| InChI |
InChI=1/C8H10O2/c1-5-3-7(9)6(2)8(10)4-5/h3-4,9-10H,1-2H3 |
| CAS Registry Number |
488-87-9 |
| EINECS |
207-688-3 |
| Estrutura Molecular |
|
| Densidade |
1.162g/cm3 |
| Ponto de fusão |
161℃ |
| Ponto de ebulição |
284.1°C at 760 mmHg |
| índice de refração |
1.582 |
| O ponto de inflamação |
140.8°C |
| Pressão de vapor |
0.00178mmHg at 25°C |
| Símbolos de perigo |
Xn:Harmful;
|
| Códigos de risco |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Descrição da Segurança |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|