ChemNet > CAS > 5380-42-7 Thiophene-2-carboxylic acid methy lester
5380-42-7 Thiophene-2-carboxylic acid methy lester
| Nome do produto |
Thiophene-2-carboxylic acid methy lester |
| Nome em inglês |
Thiophene-2-carboxylic acid methy lester; Thiophene-2-carboxylic acid methyl ester; Methyl thiophene-2-carboxylate |
| Fórmula molecular |
C6H6O2S |
| Peso Molecular |
142.1756 |
| InChI |
InChI=1/C6H6O2S/c1-8-6(7)5-3-2-4-9-5/h2-4H,1H3 |
| CAS Registry Number |
5380-42-7 |
| EINECS |
226-371-0 |
| Estrutura Molecular |
|
| Densidade |
1.217g/cm3 |
| Ponto de ebulição |
200.2°C at 760 mmHg |
| índice de refração |
1.535 |
| O ponto de inflamação |
74.9°C |
| Pressão de vapor |
0.329mmHg at 25°C |
| Símbolos de perigo |
|
| Códigos de risco |
|
| Descrição da Segurança |
S24/25:Avoid contact with skin and eyes.;
|
|
