ChemNet > CAS > 5653-62-3 2,3-Dimethoxybenzonitrile
5653-62-3 2,3-Dimethoxybenzonitrile
| Nome do produto |
2,3-Dimethoxybenzonitrile |
| Nome em inglês |
2,3-Dimethoxybenzonitrile;Benzonitrile, 2,3-dimethoxy-; 4-10-00-01418 (Beilstein Handbook Reference); BRN 2719631; NSC 27018; o-Veratronitrile (8CI) |
| Fórmula molecular |
C9H9NO2 |
| Peso Molecular |
163.17 |
| InChI |
InChI=1/C9H9NO2/c1-11-8-5-3-4-7(6-10)9(8)12-2/h3-5H,1-2H3 |
| CAS Registry Number |
5653-62-3 |
| EINECS |
227-097-4 |
| Estrutura Molecular |
|
| Ponto de fusão |
41-46℃ |
| Símbolos de perigo |
 Xn:Harmful;
|
| Códigos de risco |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Descrição da Segurança |
S36/37:Wear suitable protective clothing and gloves.;
|
|
