608-05-9 5-methylisatin
Nome do produto |
5-methylisatin |
Nome em inglês |
5-methylisatin; 5-methylindole-2,3(1H)-dione; 5-methyl-1H-indole-2,3-dione |
Fórmula molecular |
C9H7NO2 |
Peso Molecular |
161.1574 |
InChI |
InChI=1/C9H7NO2/c1-5-2-3-7-6(4-5)8(11)9(12)10-7/h2-4H,1H3,(H,10,11,12) |
CAS Registry Number |
608-05-9 |
EINECS |
210-152-1 |
Estrutura Molecular |
|
Densidade |
1.301g/cm3 |
Ponto de fusão |
180℃ (dec.) |
índice de refração |
1.598 |
Símbolos de perigo |
|
Códigos de risco |
|
Descrição da Segurança |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|