ChemNet > CAS > 61341-26-2 3-Methylthiophene-2-carbonyl chloride
61341-26-2 3-Methylthiophene-2-carbonyl chloride
| Nome do produto |
3-Methylthiophene-2-carbonyl chloride |
| Nome em inglês |
3-Methylthiophene-2-carbonyl chloride; 2-thiophenecarbonyl chloride, 3-methyl-; 3-METHYLTHIOPHENE-2-CARBONYL CHLORIDE |
| Fórmula molecular |
C6H5ClOS |
| Peso Molecular |
160.6213 |
| InChI |
InChI=1/C6H5ClOS/c1-4-2-3-9-5(4)6(7)8/h2-3H,1H3 |
| CAS Registry Number |
61341-26-2 |
| Estrutura Molecular |
|
| Densidade |
1.32g/cm3 |
| Ponto de ebulição |
219.9°C at 760 mmHg |
| índice de refração |
1.566 |
| O ponto de inflamação |
86.8°C |
| Pressão de vapor |
0.116mmHg at 25°C |
| Símbolos de perigo |
|
| Códigos de risco |
R34:Causes burns.;
|
| Descrição da Segurança |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
