ChemNet > CAS > 622-20-8 1,2-Bis(phenylthio)ethane
622-20-8 1,2-Bis(phenylthio)ethane
| Nome do produto |
1,2-Bis(phenylthio)ethane |
| Nome em inglês |
1,2-Bis(phenylthio)ethane; 1,2-Bis(phenylthio)ethane,98%; 1,1'-(ethane-1,2-diyldisulfanediyl)dibenzene |
| Fórmula molecular |
C14H14S2 |
| Peso Molecular |
246.391 |
| InChI |
InChI=1/C14H14S2/c1-3-7-13(8-4-1)15-11-12-16-14-9-5-2-6-10-14/h1-10H,11-12H2 |
| CAS Registry Number |
622-20-8 |
| EINECS |
210-723-5 |
| Estrutura Molecular |
|
| Densidade |
1.16g/cm3 |
| Ponto de ebulição |
377.3°C at 760 mmHg |
| índice de refração |
1.646 |
| O ponto de inflamação |
184.6°C |
| Pressão de vapor |
1.48E-05mmHg at 25°C |
| Símbolos de perigo |
|
| Códigos de risco |
|
| Descrição da Segurança |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
