699-18-3 2-(2-nitrovinyl)furan
Nome do produto |
2-(2-nitrovinyl)furan |
Nome em inglês |
2-(2-nitrovinyl)furan; |
Fórmula molecular |
C6H5NO3 |
Peso Molecular |
139.11 |
InChI |
InChI=1/C6H5NO3/c8-7(9)4-3-6-2-1-5-10-6/h1-5H/b4-3+ |
CAS Registry Number |
699-18-3 |
Estrutura Molecular |
|
Ponto de fusão |
72-75℃ |
Símbolos de perigo |
|
Códigos de risco |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Descrição da Segurança |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|