ChemNet > CAS > 7151-68-0 3-Methoxy-4-methylbenzoic acid
7151-68-0 3-Methoxy-4-methylbenzoic acid
| Nome do produto |
3-Methoxy-4-methylbenzoic acid |
| Nome em inglês |
3-Methoxy-4-methylbenzoic acid; 4-Methyl-m-anisic acid; 3-Methoxy-p-toluic acid~4-Methyl-m-anisic acid; 3-Methoxy-p-toluic acid (COOH=1); 3-methoxy-4-methylbenzoate |
| Fórmula molecular |
C9H9O3 |
| Peso Molecular |
165.1665 |
| InChI |
InChI=1/C9H10O3/c1-6-3-4-7(9(10)11)5-8(6)12-2/h3-5H,1-2H3,(H,10,11)/p-1 |
| CAS Registry Number |
7151-68-0 |
| EINECS |
230-486-1 |
| Estrutura Molecular |
|
| Ponto de fusão |
152-154℃ |
| Ponto de ebulição |
309.9°C at 760 mmHg |
| O ponto de inflamação |
126.2°C |
| Pressão de vapor |
0.000267mmHg at 25°C |
| Símbolos de perigo |
|
| Códigos de risco |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Descrição da Segurança |
S24/25:;
|
|
