ChemNet > CAS > 7367-82-0 ethyl trans-2-octenoate
7367-82-0 ethyl trans-2-octenoate
| Nome do produto |
ethyl trans-2-octenoate |
| Nome em inglês |
ethyl trans-2-octenoate; trans-2-Octenoic acid ethyl ester |
| Fórmula molecular |
C10H18O2 |
| Peso Molecular |
170.25
|
| InChI |
InChI=1/C10H18O2/c1-3-5-6-7-8-9-10(11)12-4-2/h8-9H,3-7H2,1-2H3/b9-8+ |
| CAS Registry Number |
7367-82-0 |
| EINECS |
230-913-1 |
| Estrutura Molecular |
|
| Densidade |
0.88 |
| Símbolos de perigo |
|
| Códigos de risco |
|
| Descrição da Segurança |
S24/25:Avoid contact with skin and eyes.;
|
|
