ChemNet > CAS > 81029-03-0 2,3-Dimethyl-p-nitroanisole
81029-03-0 2,3-Dimethyl-p-nitroanisole
| Nome do produto |
2,3-Dimethyl-p-nitroanisole |
| Nome em inglês |
2,3-Dimethyl-p-nitroanisole; 2,3-Dimethyl-4-nitroanisole; 1-methoxy-2,3-dimethyl-4-nitrobenzene |
| Fórmula molecular |
C9H11NO3 |
| Peso Molecular |
181.1885 |
| InChI |
InChI=1/C9H11NO3/c1-6-7(2)9(13-3)5-4-8(6)10(11)12/h4-5H,1-3H3 |
| CAS Registry Number |
81029-03-0 |
| EINECS |
279-674-5 |
| Estrutura Molecular |
|
| Densidade |
1.148g/cm3 |
| Ponto de fusão |
70-73℃ |
| Ponto de ebulição |
303.2°C at 760 mmHg |
| índice de refração |
1.534 |
| O ponto de inflamação |
141.2°C |
| Pressão de vapor |
0.0017mmHg at 25°C |
| Símbolos de perigo |
|
| Códigos de risco |
|
| Descrição da Segurança |
S24/25:Avoid contact with skin and eyes.;
|
|
