ChemNet > CAS > 87327-69-3 2-Chloro-6-fluoroacetophenone
87327-69-3 2-Chloro-6-fluoroacetophenone
| Nome do produto |
2-Chloro-6-fluoroacetophenone |
| Nome em inglês |
2-Chloro-6-fluoroacetophenone;1-(2-chloro-6-fluorophenyl)ethanone; 2'-Chloro-6'-fluoroacetophenone |
| Fórmula molecular |
C8H6ClFO |
| Peso Molecular |
172.584 |
| InChI |
InChI=1/C8H6ClFO/c1-5(11)8-6(9)3-2-4-7(8)10/h2-4H,1H3 |
| CAS Registry Number |
87327-69-3 |
| Estrutura Molecular |
|
| Densidade |
1.258g/cm3 |
| Ponto de ebulição |
191.8°C at 760 mmHg |
| índice de refração |
1.512 |
| O ponto de inflamação |
69.8°C |
| Pressão de vapor |
0.506mmHg at 25°C |
| Símbolos de perigo |
|
| Códigos de risco |
R36/38:Irritating to eyes and skin.;
|
| Descrição da Segurança |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
