ChemNet > CAS > 90580-64-6 4-Borono-DL-fenilalanina
90580-64-6 4-Borono-DL-fenilalanina
| Nome do produto |
4-Borono-DL-fenilalanina |
| Sinônimos |
ácido 2-amino-3-[4-(dihidroxiboril)fenil]propanoico |
| Nome em inglês |
4-Borono-DL-phenylalanine; 2-Amino-3-[4-(dihydroxyboryl)phenyl]propanoic acid |
| Fórmula molecular |
C9H12BNO4 |
| Peso Molecular |
209.00
|
| InChI |
InChI=1/C9H12BNO4/c11-8(9(12)13)5-6-1-3-7(4-2-6)10(14)15/h1-4,8,14-15H,5,11H2,(H,12,13)/t8-/m0/s1 |
| CAS Registry Number |
90580-64-6 |
| Estrutura Molecular |
|
| Ponto de fusão |
270℃ |
| Símbolos de perigo |
 Xi:Irritant;
|
| Códigos de risco |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Descrição da Segurança |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
