ChemNet > CAS > 100959-19-1 4-Methylcyclohexylamine hydrochloride
100959-19-1 4-Methylcyclohexylamine hydrochloride
| Название продукта |
4-Methylcyclohexylamine hydrochloride |
| Английское название |
4-Methylcyclohexylamine hydrochloride; 1-Amino-4-methylcyclohexane hydrochloride; 4-Methylcycohexylamine hydrochloride; 4-methylcyclohexanamine; 4-methylcyclohexanamine hydrochloride |
| Молекулярная формула |
C7H16ClN |
| Молекулярный вес |
149.6616 |
| InChI |
InChI=1/C7H15N.ClH/c1-6-2-4-7(8)5-3-6;/h6-7H,2-5,8H2,1H3;1H |
| Регистрационный номер CAS |
100959-19-1 |
| EINECS |
228-673-8 |
| Молекулярная структура |
|
| Точка кипения |
195.9°C at 760 mmHg |
| Температура вспышки |
72.3°C |
| Давление пара |
0.347mmHg at 25°C |
| Символы опасности |
|
| Риск коды |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Характеристики безопасности |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
