ChemNet > CAS > 1135-67-7 1-Phenyl-1-cyclohexanecarboxylic acid
1135-67-7 1-Phenyl-1-cyclohexanecarboxylic acid
Название продукта |
1-Phenyl-1-cyclohexanecarboxylic acid |
Английское название |
1-Phenyl-1-cyclohexanecarboxylic acid;1-Phenylcyclohexane-1-carboxylic acid; 1-phenylcyclohexanecarboxylic acid; 1-phenylcyclohexanecarboxylate |
Молекулярная формула |
C13H15O2 |
Молекулярный вес |
203.2575 |
InChI |
InChI=1/C13H16O2/c14-12(15)13(9-5-2-6-10-13)11-7-3-1-4-8-11/h1,3-4,7-8H,2,5-6,9-10H2,(H,14,15)/p-1 |
Регистрационный номер CAS |
1135-67-7 |
EINECS |
214-495-8 |
Молекулярная структура |
|
Температура плавления |
119-124℃ |
Точка кипения |
353.9°C at 760 mmHg |
Температура вспышки |
164.9°C |
Давление пара |
1.28E-05mmHg at 25°C |
Символы опасности |
|
Риск коды |
|
Характеристики безопасности |
S24/25:Avoid contact with skin and eyes.;
|
|