ChemNet > CAS > 1171-47-7 2,2-Bis-(4-carboxyphenyl)-hexafluoropropane
1171-47-7 2,2-Bis-(4-carboxyphenyl)-hexafluoropropane
Название продукта |
2,2-Bis-(4-carboxyphenyl)-hexafluoropropane |
Английское название |
2,2-Bis-(4-carboxyphenyl)-hexafluoropropane; |
Молекулярная формула |
C7H11FO2 |
Молекулярный вес |
146.1594 |
InChI |
InChI=1/C7H11FO2/c8-7(6(9)10)4-2-1-3-5-7/h1-5H2,(H,9,10) |
Регистрационный номер CAS |
1171-47-7 |
Молекулярная структура |
|
Плотность |
1.159g/cm3 |
Точка кипения |
227.566°C at 760 mmHg |
Показатель преломления |
1.454 |
Температура вспышки |
91.429°C |
Давление пара |
0.028mmHg at 25°C |
Символы опасности |
|
Риск коды |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Характеристики безопасности |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|