ChemNet > CAS > 1195-52-4 3-(3-Thienyl)acrylic acid
1195-52-4 3-(3-Thienyl)acrylic acid
Название продукта |
3-(3-Thienyl)acrylic acid |
Английское название |
3-(3-Thienyl)acrylic acid; Thiophene-3-acrylic acid; (2E)-3-thiophen-3-ylprop-2-enoate; (2Z)-3-(thiophen-3-yl)prop-2-enoic acid |
Молекулярная формула |
C7H6O2S |
Молекулярный вес |
154.1863 |
InChI |
InChI=1/C7H6O2S/c8-7(9)2-1-6-3-4-10-5-6/h1-5H,(H,8,9)/b2-1- |
Регистрационный номер CAS |
1195-52-4 |
EINECS |
214-800-4 |
Молекулярная структура |
|
Плотность |
1.346g/cm3 |
Точка кипения |
298.896°C at 760 mmHg |
Показатель преломления |
1.656 |
Температура вспышки |
134.568°C |
Давление пара |
0.001mmHg at 25°C |
Символы опасности |
|
Риск коды |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Характеристики безопасности |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|