ChemNet > CAS > 1205-06-7 4-Ethoxycarbonylphenyl isothiocyanate
1205-06-7 4-Ethoxycarbonylphenyl isothiocyanate
| Название продукта |
4-Ethoxycarbonylphenyl isothiocyanate |
| Английское название |
4-Ethoxycarbonylphenyl isothiocyanate; 4-(Ethoxycarbonyl)phenyl isothiocyanate; Ethyl 4-isothiocyanatobenzoate; 4-Isothiocyanatobenzoic acid ethyl ester |
| Молекулярная формула |
C10H9NO2S |
| Молекулярный вес |
207.249 |
| InChI |
InChI=1/C10H9NO2S/c1-2-13-10(12)8-3-5-9(6-4-8)11-7-14/h3-6H,2H2,1H3 |
| Регистрационный номер CAS |
1205-06-7 |
| EINECS |
214-880-0 |
| Молекулярная структура |
|
| Плотность |
1.14g/cm3 |
| Точка кипения |
327.5°C at 760 mmHg |
| Показатель преломления |
1.558 |
| Температура вспышки |
151.9°C |
| Давление пара |
0.000201mmHg at 25°C |
| Символы опасности |
|
| Риск коды |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Характеристики безопасности |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
