ChemNet > CAS > 1210-33-9 5-Chlorodibenzosuberane
1210-33-9 5-Chlorodibenzosuberane
| Название продукта |
5-Chlorodibenzosuberane |
| Английское название |
5-Chlorodibenzosuberane; 5-Chloro-10,11-dihydro-5H-dibenzo[a,d]cycloheptene; 5-Chlorobenzosuberane; 5H-Dibenzo[a,d]cycloheptene, 5-chloro-10,11-dihydro-; 5-chloro-10,11-dihydro-5H-dibenzo[a,d][7]annulene; 5-Chloro dibenzosuberane; Dibenzosuberyl chloride; 5-Chloro dibenzosuberane; 5-Chloro-10,11-dihydro-5H-dibenzo[a,d]cycloheptene |
| Молекулярная формула |
C15H13Cl |
| Молекулярный вес |
228.7167 |
| InChI |
InChI=1/C15H13Cl/c16-15-13-7-3-1-5-11(13)9-10-12-6-2-4-8-14(12)15/h1-8,15H,9-10H2 |
| Регистрационный номер CAS |
1210-33-9 |
| EINECS |
214-910-2 |
| Молекулярная структура |
|
| Плотность |
1.19g/cm3 |
| Точка кипения |
321.738°C at 760 mmHg |
| Показатель преломления |
1.627 |
| Температура вспышки |
136.593°C |
| Давление пара |
0.001mmHg at 25°C |
| Символы опасности |
 34:;
|
| Риск коды |
R34:Causes burns.;
|
| Характеристики безопасности |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
