ChemNet > CAS > 132741-31-2 3,5-difluoromandelic acid
132741-31-2 3,5-difluoromandelic acid
Название продукта |
3,5-difluoromandelic acid |
Английское название |
3,5-difluoromandelic acid; alpha-Hydroxy-3,5-difluorophenylacetic acid; (3,5-difluorophenyl)(hydroxy)acetic acid; (2S)-(3,5-difluorophenyl)(hydroxy)ethanoate; (2R)-(3,5-difluorophenyl)(hydroxy)ethanoate |
Молекулярная формула |
C8H5F2O3 |
Молекулярный вес |
187.1209 |
InChI |
InChI=1/C8H6F2O3/c9-5-1-4(2-6(10)3-5)7(11)8(12)13/h1-3,7,11H,(H,12,13)/p-1/t7-/m1/s1 |
Регистрационный номер CAS |
132741-31-2 |
Молекулярная структура |
|
Температура плавления |
135-139℃ |
Точка кипения |
306.5°C at 760 mmHg |
Температура вспышки |
139.1°C |
Давление пара |
0.000336mmHg at 25°C |
Символы опасности |
|
Риск коды |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Характеристики безопасности |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|