ChemNet > CAS > 14113-01-0 Ethylhydrogensuberate, (Monoethylsuberate; Subericacid monoethylester)
14113-01-0 Ethylhydrogensuberate, (Monoethylsuberate; Subericacid monoethylester)
Название продукта |
Ethylhydrogensuberate, (Monoethylsuberate; Subericacid monoethylester) |
Английское название |
Ethylhydrogensuberate, (Monoethylsuberate; Subericacid monoethylester); Ethyl hydrogen suberate; Monoethyl suberate~Octanedioic acid monoethyl ester~Suberic acid monoethyl ester; 8-ethoxy-8-oxooctanoic acid |
Молекулярная формула |
C10H18O4 |
Молекулярный вес |
202.2475 |
InChI |
InChI=1/C10H18O4/c1-2-14-10(13)8-6-4-3-5-7-9(11)12/h2-8H2,1H3,(H,11,12) |
Регистрационный номер CAS |
14113-01-0 |
EINECS |
237-968-0 |
Молекулярная структура |
|
Плотность |
1.054g/cm3 |
Точка кипения |
304.7°C at 760 mmHg |
Показатель преломления |
1.451 |
Температура вспышки |
111.7°C |
Давление пара |
0.000197mmHg at 25°C |
Символы опасности |
|
Риск коды |
R36/38:Irritating to eyes and skin.;
|
Характеристики безопасности |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|