ChemNet > CAS > 143096-86-0 2,2-Difluoro-1,3-benzodioxole-4-carbonyl chloride
143096-86-0 2,2-Difluoro-1,3-benzodioxole-4-carbonyl chloride
Название продукта |
2,2-Difluoro-1,3-benzodioxole-4-carbonyl chloride |
Английское название |
2,2-Difluoro-1,3-benzodioxole-4-carbonyl chloride;methyl tridecafluoroheptanoate; 2,2-difluoro-1,3-benzodioxole-4-carboxylate |
Молекулярная формула |
C8H3F2O4 |
Молекулярный вес |
201.1044 |
InChI |
InChI=1/C8H4F2O4/c9-8(10)13-5-3-1-2-4(7(11)12)6(5)14-8/h1-3H,(H,11,12)/p-1 |
Регистрационный номер CAS |
143096-86-0 |
Молекулярная структура |
|
Точка кипения |
260.8°C at 760 mmHg |
Температура вспышки |
111.5°C |
Давление пара |
0.0061mmHg at 25°C |
Символы опасности |
|
Риск коды |
R34:Causes burns.;
|
Характеристики безопасности |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|