ChemNet > CAS > 1505-52-8 3-Methylthianaphthene-2-acetic acid
1505-52-8 3-Methylthianaphthene-2-acetic acid
| Название продукта |
3-Methylthianaphthene-2-acetic acid |
| Английское название |
3-Methylthianaphthene-2-acetic acid; 2-(3-Methylbenzo[b]thiophen-2-yl)acetic acid; (3-methyl-1-benzothiophen-2-yl)acetic acid; (3-methyl-1-benzothiophen-2-yl)acetate |
| Молекулярная формула |
C11H9O2S |
| Молекулярный вес |
205.2535 |
| InChI |
InChI=1/C11H10O2S/c1-7-8-4-2-3-5-9(8)14-10(7)6-11(12)13/h2-5H,6H2,1H3,(H,12,13)/p-1 |
| Регистрационный номер CAS |
1505-52-8 |
| Молекулярная структура |
|
| Температура плавления |
148-150℃ |
| Точка кипения |
391.8°C at 760 mmHg |
| Температура вспышки |
190.8°C |
| Давление пара |
7.65E-07mmHg at 25°C |
| Символы опасности |
 Xi:Irritant;
|
| Риск коды |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Характеристики безопасности |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
