ChemNet > CAS > 1513-60-6 ethyl 4,4,4-trifluoro-3-(trifluoromethyl)crotonate
1513-60-6 ethyl 4,4,4-trifluoro-3-(trifluoromethyl)crotonate
| Название продукта |
ethyl 4,4,4-trifluoro-3-(trifluoromethyl)crotonate |
| Английское название |
ethyl 4,4,4-trifluoro-3-(trifluoromethyl)crotonate; Ethyl-4,4,4-trifluoro-3-(trifluoromethyl)-crotonate; 4,4,4-Trifluoro-3-(trifluoromethyl)crotonic acid ethyl ester; 1-ethynyl-3,5-difluorobenzene |
| Молекулярная формула |
C8H4F2 |
| Молекулярный вес |
138.1142 |
| InChI |
InChI=1/C8H4F2/c1-2-6-3-7(9)5-8(10)4-6/h1,3-5H |
| Регистрационный номер CAS |
1513-60-6 |
| Молекулярная структура |
|
| Плотность |
1.17g/cm3 |
| Точка кипения |
147.1°C at 760 mmHg |
| Показатель преломления |
1.492 |
| Температура вспышки |
32°C |
| Давление пара |
5.69mmHg at 25°C |
| Символы опасности |
|
| Риск коды |
R10:Flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Характеристики безопасности |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
