ChemNet > CAS > 1594-56-5 2,4-Dinitrophenyl thiocyanate
1594-56-5 2,4-Dinitrophenyl thiocyanate
| Название продукта |
2,4-Dinitrophenyl thiocyanate |
| Английское название |
2,4-Dinitrophenyl thiocyanate; 2,4-Dinitrothiocyanatobenzene |
| Молекулярная формула |
C7H3N3O4S |
| Молекулярный вес |
225.1814 |
| InChI |
InChI=1/C7H3N3O4S/c8-4-15-7-2-1-5(9(11)12)3-6(7)10(13)14/h1-3H |
| Регистрационный номер CAS |
1594-56-5 |
| EINECS |
216-477-5 |
| Молекулярная структура |
|
| Плотность |
1.62g/cm3 |
| Температура плавления |
138-140℃ |
| Точка кипения |
368.4°C at 760 mmHg |
| Показатель преломления |
1.666 |
| Температура вспышки |
176.6°C |
| Давление пара |
1.28E-05mmHg at 25°C |
| Символы опасности |
|
| Риск коды |
R32:Contact with acids liberates very toxic gas.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Характеристики безопасности |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
