ChemNet > CAS > 16382-15-3 Ethyl 5-methylindole-2-carboxylate
16382-15-3 Ethyl 5-methylindole-2-carboxylate
| Название продукта |
Ethyl 5-methylindole-2-carboxylate |
| Английское название |
Ethyl 5-methylindole-2-carboxylate; 5-Methylindole-2-carboxylic acid ethyl ester; ethyl 5-methyl-1H-indole-2-carboxylate |
| Молекулярная формула |
C12H13NO2 |
| Молекулярный вес |
203.2371 |
| InChI |
InChI=1/C12H13NO2/c1-3-15-12(14)11-7-9-6-8(2)4-5-10(9)13-11/h4-7,13H,3H2,1-2H3 |
| Регистрационный номер CAS |
16382-15-3 |
| Молекулярная структура |
|
| Плотность |
1.177g/cm3 |
| Точка кипения |
356.5°C at 760 mmHg |
| Показатель преломления |
1.609 |
| Температура вспышки |
169.4°C |
| Давление пара |
2.9E-05mmHg at 25°C |
| Символы опасности |
|
| Риск коды |
|
| Характеристики безопасности |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
