ChemNet > CAS > 177842-14-7 4-(difluoromethoxy)benzylamine
177842-14-7 4-(difluoromethoxy)benzylamine
Название продукта |
4-(difluoromethoxy)benzylamine |
Английское название |
4-(difluoromethoxy)benzylamine;1-[4-(difluoromethoxy)phenyl]methanamine |
Молекулярная формула |
C8H9F2NO |
Молекулярный вес |
173.16 |
InChI |
InChI=1/C8H9F2NO/c9-8(10)12-7-3-1-6(5-11)2-4-7/h1-4,8H,5,11H2 |
Регистрационный номер CAS |
177842-14-7 |
Молекулярная структура |
|
Плотность |
1.196g/cm3 |
Точка кипения |
227.3°C at 760 mmHg |
Показатель преломления |
1.487 |
Температура вспышки |
91.3°C |
Давление пара |
0.0781mmHg at 25°C |
Символы опасности |
|
Риск коды |
R34:Causes burns.;
|
Характеристики безопасности |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|