ChemNet > CAS > 17969-22-1 4-(chloromethyl)-2-(4-chlorophenyl)-1,3-thiazole
17969-22-1 4-(chloromethyl)-2-(4-chlorophenyl)-1,3-thiazole
| Название продукта |
4-(chloromethyl)-2-(4-chlorophenyl)-1,3-thiazole |
| Английское название |
4-(chloromethyl)-2-(4-chlorophenyl)-1,3-thiazole; |
| Молекулярная формула |
C10H7Cl2NS |
| Молекулярный вес |
244.1403 |
| InChI |
InChI=1/C10H7Cl2NS/c11-5-9-6-14-10(13-9)7-1-3-8(12)4-2-7/h1-4,6H,5H2 |
| Регистрационный номер CAS |
17969-22-1 |
| Молекулярная структура |
|
| Плотность |
1.378g/cm3 |
| Температура плавления |
78℃ |
| Точка кипения |
374°C at 760 mmHg |
| Показатель преломления |
1.617 |
| Температура вспышки |
180°C |
| Давление пара |
1.85E-05mmHg at 25°C |
| Символы опасности |
 C:Corrosive;
|
| Риск коды |
R34:Causes burns.;
|
| Характеристики безопасности |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
