ChemNet > CAS > 18719-43-2 diethyl (3-chloropropyl)malonate
18719-43-2 diethyl (3-chloropropyl)malonate
Название продукта |
diethyl (3-chloropropyl)malonate |
Английское название |
diethyl (3-chloropropyl)malonate; (3-Chloropropyl)malonic acid diethyl ester; diethyl (3-chloropropyl)propanedioate |
Молекулярная формула |
C10H17ClO4 |
Молекулярный вес |
236.6926 |
InChI |
InChI=1/C10H17ClO4/c1-3-14-9(12)8(6-5-7-11)10(13)15-4-2/h8H,3-7H2,1-2H3 |
Регистрационный номер CAS |
18719-43-2 |
Молекулярная структура |
|
Плотность |
1.114g/cm3 |
Точка кипения |
290.2°C at 760 mmHg |
Показатель преломления |
1.447 |
Температура вспышки |
111.9°C |
Давление пара |
0.0021mmHg at 25°C |
Символы опасности |
|
Риск коды |
R36/38:Irritating to eyes and skin.;
|
Характеристики безопасности |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|