ChemNet > CAS > 19471-12-6 3,3'-methylenedianiline
19471-12-6 3,3'-methylenedianiline
| Название продукта |
3,3'-methylenedianiline |
| Английское название |
3,3'-methylenedianiline; 3,3-Diaminodiphenylmethane; 3,3'-DIAMINODIPHENYLMETHANE |
| Молекулярная формула |
C13H14N2 |
| Молекулярный вес |
198.26 |
| InChI |
InChI=1/C13H14N2/c14-12-5-1-3-10(8-12)7-11-4-2-6-13(15)9-11/h1-6,8-9H,7,14-15H2 |
| Регистрационный номер CAS |
19471-12-6 |
| Молекулярная структура |
|
| Температура плавления |
81-84℃ |
| Символы опасности |
|
| Риск коды |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R45:May cause cancer.;
|
| Характеристики безопасности |
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
S53:Avoid exposure - obtain special instructions before use.;
|
|
