ChemNet > CAS > 20300-02-1 Thiophene-2-thiocarboxamide
20300-02-1 Thiophene-2-thiocarboxamide
| Название продукта |
Thiophene-2-thiocarboxamide |
| Английское название |
Thiophene-2-thiocarboxamide; Thiophene-2-carbothioamide |
| Молекулярная формула |
C5H5NS2 |
| Молекулярный вес |
143.2299 |
| InChI |
InChI=1/C5H5NS2/c6-5(7)4-2-1-3-8-4/h1-3H,(H2,6,7) |
| Регистрационный номер CAS |
20300-02-1 |
| Молекулярная структура |
|
| Плотность |
1.357g/cm3 |
| Температура плавления |
106℃ |
| Точка кипения |
259.5°C at 760 mmHg |
| Показатель преломления |
1.701 |
| Температура вспышки |
110.7°C |
| Давление пара |
0.0129mmHg at 25°C |
| Символы опасности |
 Xi:Irritant;
|
| Риск коды |
R25:Toxic if swallowed.;
|
| Характеристики безопасности |
S22:Do not inhale dust.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
