ChemNet > CAS > 207981-50-8 2,6-difluoromandelic acid
207981-50-8 2,6-difluoromandelic acid
| Название продукта |
2,6-difluoromandelic acid |
| Английское название |
2,6-difluoromandelic acid; alpha-Hydroxy-2,6-difluorophenylacetic acid; (2,6-difluorophenyl)(hydroxy)acetic acid |
| Молекулярная формула |
C8H6F2O3 |
| Молекулярный вес |
188.1282 |
| InChI |
InChI=1/C8H6F2O3/c9-4-2-1-3-5(10)6(4)7(11)8(12)13/h1-3,7,11H,(H,12,13) |
| Регистрационный номер CAS |
207981-50-8 |
| Молекулярная структура |
|
| Плотность |
1.522g/cm3 |
| Точка кипения |
299.3°C at 760 mmHg |
| Показатель преломления |
1.542 |
| Температура вспышки |
134.8°C |
| Давление пара |
0.000539mmHg at 25°C |
| Символы опасности |
|
| Риск коды |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Характеристики безопасности |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
