ChemNet > CAS > 2107-77-9 7,8-Dihydroxy-4-methylcoumarin
2107-77-9 7,8-Dihydroxy-4-methylcoumarin
| Название продукта |
7,8-Dihydroxy-4-methylcoumarin |
| Английское название |
7,8-Dihydroxy-4-methylcoumarin; 4-Methyldaphnetin; 7,8-dihydroxy-4-methyl-2H-chromen-2-one |
| Молекулярная формула |
C10H8O4 |
| Молекулярный вес |
192.1681 |
| InChI |
InChI=1/C10H8O4/c1-5-4-8(12)14-10-6(5)2-3-7(11)9(10)13/h2-4,11,13H,1H3 |
| Регистрационный номер CAS |
2107-77-9 |
| EINECS |
218-290-4 |
| Молекулярная структура |
|
| Плотность |
1.456g/cm3 |
| Точка кипения |
421.5°C at 760 mmHg |
| Показатель преломления |
1.651 |
| Температура вспышки |
176°C |
| Давление пара |
1.05E-07mmHg at 25°C |
| Символы опасности |
|
| Риск коды |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Характеристики безопасности |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
