ChemNet > CAS > 2131-55-7 4-Chlorophenyl isothiocyanate
2131-55-7 4-Chlorophenyl isothiocyanate
| Название продукта |
4-Chlorophenyl isothiocyanate |
| Английское название |
4-Chlorophenyl isothiocyanate; Isothiocyanic Acid 4-Chlorophenyl Ester; 1-chloro-4-isothiocyanatobenzene; 4-Chloro-phenylisothiocyanate |
| Молекулярная формула |
C7H4ClNS |
| Молекулярный вес |
169.6314 |
| InChI |
InChI=1/C7H4ClNS/c8-6-1-3-7(4-2-6)9-5-10/h1-4H |
| Регистрационный номер CAS |
2131-55-7 |
| EINECS |
218-358-3 |
| Молекулярная структура |
|
| Плотность |
1.21g/cm3 |
| Температура плавления |
43-136℃ |
| Точка кипения |
250.2°C at 760 mmHg |
| Показатель преломления |
1.593 |
| Температура вспышки |
105.1°C |
| Давление пара |
0.0347mmHg at 25°C |
| Символы опасности |
 Xn:Harmful;
|
| Риск коды |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Характеристики безопасности |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
