ChemNet > CAS > 2386-26-7 ethyl 4-acetyl-3,5-dimethyl-1H-pyrrole-2-carboxylate
2386-26-7 ethyl 4-acetyl-3,5-dimethyl-1H-pyrrole-2-carboxylate
| Название продукта |
ethyl 4-acetyl-3,5-dimethyl-1H-pyrrole-2-carboxylate |
| Английское название |
ethyl 4-acetyl-3,5-dimethyl-1H-pyrrole-2-carboxylate; 3-Acetyl-2,4-dimethyl-5-carbethoxypyrrole; 4-acetyl-3,5-dimethyl-1H-pyrrol-2-yl propanoate |
| Молекулярная формула |
C11H15NO3 |
| Молекулярный вес |
209.2417 |
| InChI |
InChI=1/C11H15NO3/c1-5-9(14)15-11-6(2)10(8(4)13)7(3)12-11/h12H,5H2,1-4H3 |
| Регистрационный номер CAS |
2386-26-7 |
| Молекулярная структура |
|
| Плотность |
1.125g/cm3 |
| Температура плавления |
139℃ |
| Точка кипения |
348.9°C at 760 mmHg |
| Показатель преломления |
1.517 |
| Температура вспышки |
164.8°C |
| Давление пара |
4.89E-05mmHg at 25°C |
| Символы опасности |
 Xi:Irritant;
|
| Риск коды |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Характеристики безопасности |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
