ChemNet > CAS > 24426-16-2 N,N-Diethyldiethylenetriamine
24426-16-2 N,N-Diethyldiethylenetriamine
| Название продукта |
N,N-Diethyldiethylenetriamine |
| Английское название |
N,N-Diethyldiethylenetriamine; N,N-Diethyldiethykenetriamine; N-(2-Diethylaminoethyl)ethylenediamine; N'-(2-aminoethyl)-N,N-diethylethane-1,2-diamine; N'-(2-ammonioethyl)-N,N-diethylethane-1,2-diaminium |
| Молекулярная формула |
C8H24N3 |
| Молекулярный вес |
162.2946 |
| InChI |
InChI=1/C8H21N3/c1-3-11(4-2)8-7-10-6-5-9/h10H,3-9H2,1-2H3/p+3 |
| Регистрационный номер CAS |
24426-16-2 |
| EINECS |
246-242-2 |
| Молекулярная структура |
|
| Точка кипения |
227°C at 760 mmHg |
| Температура вспышки |
91.1°C |
| Давление пара |
0.0796mmHg at 25°C |
| Символы опасности |
|
| Риск коды |
R34:Causes burns.;
|
| Характеристики безопасности |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
