ChemNet > CAS > 261762-45-2 2-Chloro-3,6-difluorobenzylamine
261762-45-2 2-Chloro-3,6-difluorobenzylamine
Название продукта |
2-Chloro-3,6-difluorobenzylamine |
Английское название |
2-Chloro-3,6-difluorobenzylamine;1-(2-chloro-3,6-difluorophenyl)methanamine |
Молекулярная формула |
C7H6ClF2N |
Молекулярный вес |
177.579 |
InChI |
InChI=1/C7H6ClF2N/c8-7-4(3-11)5(9)1-2-6(7)10/h1-2H,3,11H2 |
Регистрационный номер CAS |
261762-45-2 |
Молекулярная структура |
|
Плотность |
1.368g/cm3 |
Точка кипения |
210.3°C at 760 mmHg |
Показатель преломления |
1.522 |
Температура вспышки |
81°C |
Давление пара |
0.194mmHg at 25°C |
Символы опасности |
|
Риск коды |
R34:Causes burns.;
|
Характеристики безопасности |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|