ChemNet > CAS > 2855-27-8 1,2,4-Trivinylcyclohexane, mixture of isomers
2855-27-8 1,2,4-Trivinylcyclohexane, mixture of isomers
Название продукта |
1,2,4-Trivinylcyclohexane, mixture of isomers |
Английское название |
1,2,4-Trivinylcyclohexane, mixture of isomers; cyclohexane-1,2,4-triyltris(ethylene); 1,2,4-Trivinyl cyclohexane = TVCH; 1,2,4-Trivinylcyclohexane; 1,2,4-triethenylcyclohexane |
Молекулярная формула |
C12H18 |
Молекулярный вес |
162.2713 |
InChI |
InChI=1/C12H18/c1-4-10-7-8-11(5-2)12(6-3)9-10/h4-6,10-12H,1-3,7-9H2 |
Регистрационный номер CAS |
2855-27-8 |
EINECS |
220-668-9 |
Молекулярная структура |
|
Плотность |
0.96g/cm3 |
Точка кипения |
198.4°C at 760 mmHg |
Показатель преломления |
1.628 |
Температура вспышки |
68.9°C |
Давление пара |
0.508mmHg at 25°C |
Символы опасности |
Xi:Irritant;
|
Риск коды |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Характеристики безопасности |
S24/25:Avoid contact with skin and eyes.;
|
|