ChemNet > CAS > 3893-23-0 Cyclohexylphenylacetonitrile
3893-23-0 Cyclohexylphenylacetonitrile
Название продукта |
Cyclohexylphenylacetonitrile |
Английское название |
Cyclohexylphenylacetonitrile; alpha-Phenylcyclohexaneacetonitrile; alpha-Cyclohexylphenylacetonitrile; (2S)-cyclohexyl(phenyl)ethanenitrile; (2R)-cyclohexyl(phenyl)ethanenitrile |
Молекулярная формула |
C14H17N |
Молекулярный вес |
199.2915 |
InChI |
InChI=1/C14H17N/c15-11-14(12-7-3-1-4-8-12)13-9-5-2-6-10-13/h1,3-4,7-8,13-14H,2,5-6,9-10H2/t14-/m0/s1 |
Регистрационный номер CAS |
3893-23-0 |
EINECS |
223-442-8 |
Молекулярная структура |
|
Плотность |
1.019g/cm3 |
Температура плавления |
49-55℃ |
Точка кипения |
322.5°C at 760 mmHg |
Показатель преломления |
1.54 |
Температура вспышки |
156.3°C |
Давление пара |
0.000279mmHg at 25°C |
Символы опасности |
Xn:Harmful;
|
Риск коды |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Характеристики безопасности |
S36/37:Wear suitable protective clothing and gloves.;
|
|