ChemNet > CAS > 3894-09-5 Cyclohexylphenylacetic acid
3894-09-5 Cyclohexylphenylacetic acid
Название продукта |
Cyclohexylphenylacetic acid |
Английское название |
Cyclohexylphenylacetic acid; alpha-Phenylcyclohexaneacetic acid; (2R)-cyclohexyl(phenyl)ethanoate; (2S)-cyclohexyl(phenyl)ethanoate |
Молекулярная формула |
C14H17O2 |
Молекулярный вес |
217.2841 |
InChI |
InChI=1/C14H18O2/c15-14(16)13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1,3-4,7-8,12-13H,2,5-6,9-10H2,(H,15,16)/p-1/t13-/m1/s1 |
Регистрационный номер CAS |
3894-09-5 |
EINECS |
223-443-3 |
Молекулярная структура |
|
Температура плавления |
148-151℃ |
Точка кипения |
353.3°C at 760 mmHg |
Температура вспышки |
250.2°C |
Давление пара |
1.34E-05mmHg at 25°C |
Символы опасности |
Xi:Irritant;
|
Риск коды |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Характеристики безопасности |
S24/25:Avoid contact with skin and eyes.;
|
|