ChemNet > CAS > 40594-30-7 2,4-difluorophenylhydrazine
40594-30-7 2,4-difluorophenylhydrazine
| Название продукта |
2,4-difluorophenylhydrazine |
| Английское название |
2,4-difluorophenylhydrazine; 1-(2,4-Difluorophenyl)hydrazine; (2,4-difluorophenyl)hydrazine hydrochloride |
| Молекулярная формула |
C6H7ClF2N2 |
| Молекулярный вес |
180.583 |
| InChI |
InChI=1/C6H6F2N2.ClH/c7-4-1-2-6(10-9)5(8)3-4;/h1-3,10H,9H2;1H |
| Регистрационный номер CAS |
40594-30-7 |
| Молекулярная структура |
|
| Температура плавления |
65-67℃ |
| Точка кипения |
185.1°C at 760 mmHg |
| Температура вспышки |
65.7°C |
| Давление пара |
0.71mmHg at 25°C |
| Символы опасности |
 Xn:Harmful;
|
| Риск коды |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Характеристики безопасности |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
