ChemNet > CAS > 40932-60-3 3,5,6-Trichlorosalicylic acid
40932-60-3 3,5,6-Trichlorosalicylic acid
Название продукта |
3,5,6-Trichlorosalicylic acid |
Английское название |
3,5,6-Trichlorosalicylic acid; 3,5,6-Trichloro-2-hydroxybenzoic acid; 2,3,5-trichloro-6-hydroxybenzoic acid; 2,3,5-trichloro-6-hydroxybenzoate |
Молекулярная формула |
C7H2Cl3O3 |
Молекулярный вес |
240.4485 |
InChI |
InChI=1/C7H3Cl3O3/c8-2-1-3(9)6(11)4(5(2)10)7(12)13/h1,11H,(H,12,13)/p-1 |
Регистрационный номер CAS |
40932-60-3 |
EINECS |
255-144-9 |
Молекулярная структура |
|
Температура плавления |
209-211℃ |
Точка кипения |
335°C at 760 mmHg |
Температура вспышки |
156.4°C |
Давление пара |
4.87E-05mmHg at 25°C |
Символы опасности |
|
Риск коды |
R20/22:Harmful by inhalation and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Характеристики безопасности |
S22:Do not inhale dust.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|