ChemNet > CAS > 423768-53-0 ethyl 1-cyclopropyl-4-formyl-2,5-dimethyl-1H-pyrrole-3-carboxylate
423768-53-0 ethyl 1-cyclopropyl-4-formyl-2,5-dimethyl-1H-pyrrole-3-carboxylate
| Название продукта |
ethyl 1-cyclopropyl-4-formyl-2,5-dimethyl-1H-pyrrole-3-carboxylate |
| Английское название |
ethyl 1-cyclopropyl-4-formyl-2,5-dimethyl-1H-pyrrole-3-carboxylate; |
| Молекулярная формула |
C13H17NO3 |
| Молекулярный вес |
235.279 |
| InChI |
InChI=1/C13H17NO3/c1-4-17-13(16)12-9(3)14(10-5-6-10)8(2)11(12)7-15/h7,10H,4-6H2,1-3H3 |
| Регистрационный номер CAS |
423768-53-0 |
| Молекулярная структура |
|
| Плотность |
1.21g/cm3 |
| Температура плавления |
75℃ |
| Точка кипения |
391.9°C at 760 mmHg |
| Показатель преломления |
1.571 |
| Температура вспышки |
190.8°C |
| Давление пара |
2.38E-06mmHg at 25°C |
| Символы опасности |
 Xi:Irritant;
|
| Риск коды |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Характеристики безопасности |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
