ChemNet > CAS > 4815-30-9 Diethyl 5-amino-3-methyl-2,4-thiophenedicarboxylate
4815-30-9 Diethyl 5-amino-3-methyl-2,4-thiophenedicarboxylate
Название продукта |
Diethyl 5-amino-3-methyl-2,4-thiophenedicarboxylate |
Английское название |
Diethyl 5-amino-3-methyl-2,4-thiophenedicarboxylate; 5-Amino-3-methyl-2,4-thiophenedicarboxilic acid diethyl ester; diethyl 5-amino-3-methylthiophene-2,4-dicarboxylate |
Молекулярная формула |
C11H15NO4S |
Молекулярный вес |
257.3061 |
InChI |
InChI=1/C11H15NO4S/c1-4-15-10(13)7-6(3)8(17-9(7)12)11(14)16-5-2/h4-5,12H2,1-3H3 |
Регистрационный номер CAS |
4815-30-9 |
EINECS |
225-388-0 |
Молекулярная структура |
|
Плотность |
1.247g/cm3 |
Температура плавления |
103-108℃ |
Точка кипения |
372.6°C at 760 mmHg |
Показатель преломления |
1.558 |
Температура вспышки |
179.1°C |
Давление пара |
9.51E-06mmHg at 25°C |
Символы опасности |
|
Риск коды |
|
Характеристики безопасности |
S24/25:Avoid contact with skin and eyes.;
|
|